C16H16FN3O2 — CID 51097261
2-[(4-fluorophenyl)methyl-prop-2-ynylamino]-N-(3-methyl-1,2-oxazol-5-yl)acetamide (PubChem CID 51097261) has the molecular formula C16H16FN3O2 and a molecular weight of 301.32 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl-prop-2-ynylamino]-N-(3-methyl-1,2-oxazol-5-yl)acetamide.
| Compound Name | 2-[(4-fluorophenyl)methyl-prop-2-ynylamino]-N-(3-methyl-1,2-oxazol-5-yl)acetamide |
|---|---|
| PubChem CID | 51097261 |
| Molecular Formula | C16H16FN3O2 |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl-prop-2-ynylamino]-N-(3-methyl-1,2-oxazol-5-yl)acetamide |
| SMILES | C#CCN(CC(=O)Nc1cc(C)no1)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C16H16FN3O2/c1-3-8-20(10-13-4-6-14(17)7-5-13)11-15(21)18-16-9-12(2)19-22-16/h1,4-7,9H,8,10-11H2,2H3,(H,18,21) |
| InChIKey | MTCPEVCJIYJXNP-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|