C14H14FN3O — CID 86860846
N-[(4-fluorophenyl)methyl]-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]prop-2-yn-1-amine (PubChem CID 86860846) has the molecular formula C14H14FN3O and a molecular weight of 259.28 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]prop-2-yn-1-amine.
| Compound Name | N-[(4-fluorophenyl)methyl]-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 86860846 |
| Molecular Formula | C14H14FN3O |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]prop-2-yn-1-amine |
| SMILES | C#CCN(Cc1ccc(F)cc1)Cc1nc(C)no1 |
| InChI | InChI=1S/C14H14FN3O/c1-3-8-18(10-14-16-11(2)17-19-14)9-12-4-6-13(15)7-5-12/h1,4-7H,8-10H2,2H3 |
| InChIKey | YIYCDNMRPBXNFY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|