C14H20N2O6S — CID 51099918
ethyl 3-[cyclopropylmethyl-(5-sulfamoylfuran-2-carbonyl)amino]propanoate (PubChem CID 51099918) has the molecular formula C14H20N2O6S and a molecular weight of 344.39 g/mol. Its IUPAC name is ethyl 3-[cyclopropylmethyl-(5-sulfamoylfuran-2-carbonyl)amino]propanoate.
| Compound Name | ethyl 3-[cyclopropylmethyl-(5-sulfamoylfuran-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 51099918 |
| Molecular Formula | C14H20N2O6S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | ethyl 3-[cyclopropylmethyl-(5-sulfamoylfuran-2-carbonyl)amino]propanoate |
| SMILES | CCOC(=O)CCN(CC1CC1)C(=O)c1ccc(S(N)(=O)=O)o1 |
| InChI | InChI=1S/C14H20N2O6S/c1-2-21-12(17)7-8-16(9-10-3-4-10)14(18)11-5-6-13(22-11)23(15,19)20/h5-6,10H,2-4,7-9H2,1H3,(H2,15,19,20) |
| InChIKey | RLXAQCPGMSMTMP-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 119.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |