C20H29NO3 — CID 51103888
1-[4-[(4-methoxyphenyl)methyl]piperidin-1-yl]-3-(oxolan-2-yl)propan-1-one (PubChem CID 51103888) has the molecular formula C20H29NO3 and a molecular weight of 331.46 g/mol. Its IUPAC name is 1-[4-[(4-methoxyphenyl)methyl]piperidin-1-yl]-3-(oxolan-2-yl)propan-1-one.
| Compound Name | 1-[4-[(4-methoxyphenyl)methyl]piperidin-1-yl]-3-(oxolan-2-yl)propan-1-one |
|---|---|
| PubChem CID | 51103888 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | 1-[4-[(4-methoxyphenyl)methyl]piperidin-1-yl]-3-(oxolan-2-yl)propan-1-one |
| SMILES | COc1ccc(CC2CCN(C(=O)CCC3CCCO3)CC2)cc1 |
| InChI | InChI=1S/C20H29NO3/c1-23-18-6-4-16(5-7-18)15-17-10-12-21(13-11-17)20(22)9-8-19-3-2-14-24-19/h4-7,17,19H,2-3,8-15H2,1H3 |
| InChIKey | HGEHHMIKMWQVQK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |