C14H11N3O6S — CID 51106763
4-[(2-carbamoyl-1-benzofuran-3-yl)sulfamoyl]-1H-pyrrole-2-carboxylic acid (PubChem CID 51106763) has the molecular formula C14H11N3O6S and a molecular weight of 349.32 g/mol. Its IUPAC name is 4-[(2-carbamoyl-1-benzofuran-3-yl)sulfamoyl]-1H-pyrrole-2-carboxylic acid.
| Compound Name | 4-[(2-carbamoyl-1-benzofuran-3-yl)sulfamoyl]-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 51106763 |
| Molecular Formula | C14H11N3O6S |
| Molecular Weight | 349.32 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | 4-[(2-carbamoyl-1-benzofuran-3-yl)sulfamoyl]-1H-pyrrole-2-carboxylic acid |
| SMILES | NC(=O)c1oc2ccccc2c1NS(=O)(=O)c1c[nH]c(C(=O)O)c1 |
| InChI | InChI=1S/C14H11N3O6S/c15-13(18)12-11(8-3-1-2-4-10(8)23-12)17-24(21,22)7-5-9(14(19)20)16-6-7/h1-6,16-17H,(H2,15,18)(H,19,20) |
| InChIKey | LFGKRMAEXSWFRU-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 155.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.32 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |