C25H27N3O4 — CID 51112139
6-[4-[hydroxy(phenyl)methyl]piperidine-1-carbonyl]-2-(2-phenoxyethyl)pyridazin-3-one (PubChem CID 51112139) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is 6-[4-[hydroxy(phenyl)methyl]piperidine-1-carbonyl]-2-(2-phenoxyethyl)pyridazin-3-one.
| Compound Name | 6-[4-[hydroxy(phenyl)methyl]piperidine-1-carbonyl]-2-(2-phenoxyethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 51112139 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 6-[4-[hydroxy(phenyl)methyl]piperidine-1-carbonyl]-2-(2-phenoxyethyl)pyridazin-3-one |
| SMILES | O=C(c1ccc(=O)n(CCOc2ccccc2)n1)N1CCC(C(O)c2ccccc2)CC1 |
| InChI | InChI=1S/C25H27N3O4/c29-23-12-11-22(26-28(23)17-18-32-21-9-5-2-6-10-21)25(31)27-15-13-20(14-16-27)24(30)19-7-3-1-4-8-19/h1-12,20,24,30H,13-18H2 |
| InChIKey | PZFGTYBMYTWYIS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |