C23H24N4O5 — CID 38213819
N-[1-(furan-3-carbonyl)piperidin-4-yl]-6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxamide (PubChem CID 38213819) has the molecular formula C23H24N4O5 and a molecular weight of 436.47 g/mol. Its IUPAC name is N-[1-(furan-3-carbonyl)piperidin-4-yl]-6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxamide.
| Compound Name | N-[1-(furan-3-carbonyl)piperidin-4-yl]-6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 38213819 |
| Molecular Formula | C23H24N4O5 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | N-[1-(furan-3-carbonyl)piperidin-4-yl]-6-oxo-1-(2-phenoxyethyl)pyridazine-3-carboxamide |
| SMILES | O=C(NC1CCN(C(=O)c2ccoc2)CC1)c1ccc(=O)n(CCOc2ccccc2)n1 |
| InChI | InChI=1S/C23H24N4O5/c28-21-7-6-20(25-27(21)13-15-32-19-4-2-1-3-5-19)22(29)24-18-8-11-26(12-9-18)23(30)17-10-14-31-16-17/h1-7,10,14,16,18H,8-9,11-13,15H2,(H,24,29) |
| InChIKey | BYHRDQHBDYFTGQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 106.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |