About 4-nitrobenzene-1,2-diamine
4-nitrobenzene-1,2-diamine (PubChem CID 5111791) has the molecular formula C6H7N3O2
and a molecular weight of 153.14 g/mol. Its IUPAC name is 4-nitrobenzene-1,2-diamine.
Molecular Properties
| Compound Name | 4-nitrobenzene-1,2-diamine |
| PubChem CID | 5111791 |
| Molecular Formula | C6H7N3O2 |
| Molecular Weight | 153.14 g/mol |
| Exact Mass | 153.05 |
| IUPAC Name | 4-nitrobenzene-1,2-diamine |
| SMILES | Nc1ccc([N+](=O)[O-])cc1N |
| InChI | InChI=1S/C6H7N3O2/c7-5-2-1-4(9(10)11)3-6(5)8/h1-3H,7-8H2 |
| InChIKey | RAUWPNXIALNKQM-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.14 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitrobenzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitrobenzene-1,2-diamine?
The IUPAC name of 4-nitrobenzene-1,2-diamine (CID 5111791) is 4-nitrobenzene-1,2-diamine.
What is the SMILES notation for 4-nitrobenzene-1,2-diamine?
The canonical SMILES for 4-nitrobenzene-1,2-diamine is Nc1ccc([N+](=O)[O-])cc1N.
What is the InChIKey of 4-nitrobenzene-1,2-diamine?
The InChIKey is RAUWPNXIALNKQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O2/c7-5-2-1-4(9(10)11)3-6(5)8/h1-3H,7-8H2.
What are the key properties of 4-nitrobenzene-1,2-diamine?
4-nitrobenzene-1,2-diamine has a molecular weight of 153.14 g/mol, XLogP of 0.76, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitrobenzene-1,2-diamine is sourced from PubChem (CID 5111791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).