C19H21F3N2O2 — CID 51118138
2-methoxy-N-[2-methyl-1-[3-(trifluoromethyl)phenyl]-4,5,6,7-tetrahydroindol-4-yl]acetamide (PubChem CID 51118138) has the molecular formula C19H21F3N2O2 and a molecular weight of 366.38 g/mol. Its IUPAC name is 2-methoxy-N-[2-methyl-1-[3-(trifluoromethyl)phenyl]-4,5,6,7-tetrahydroindol-4-yl]acetamide.
| Compound Name | 2-methoxy-N-[2-methyl-1-[3-(trifluoromethyl)phenyl]-4,5,6,7-tetrahydroindol-4-yl]acetamide |
|---|---|
| PubChem CID | 51118138 |
| Molecular Formula | C19H21F3N2O2 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 2-methoxy-N-[2-methyl-1-[3-(trifluoromethyl)phenyl]-4,5,6,7-tetrahydroindol-4-yl]acetamide |
| SMILES | COCC(=O)NC1CCCc2c1cc(C)n2-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H21F3N2O2/c1-12-9-15-16(23-18(25)11-26-2)7-4-8-17(15)24(12)14-6-3-5-13(10-14)19(20,21)22/h3,5-6,9-10,16H,4,7-8,11H2,1-2H3,(H,23,25) |
| InChIKey | GLLJOOBKFQZWFT-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|