C13H16F3N3O3S — CID 51118680
2-methoxy-N-[3-[2-(trifluoromethylsulfanyl)ethylcarbamoylamino]phenyl]acetamide (PubChem CID 51118680) has the molecular formula C13H16F3N3O3S and a molecular weight of 351.35 g/mol. Its IUPAC name is 2-methoxy-N-[3-[2-(trifluoromethylsulfanyl)ethylcarbamoylamino]phenyl]acetamide.
| Compound Name | 2-methoxy-N-[3-[2-(trifluoromethylsulfanyl)ethylcarbamoylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 51118680 |
| Molecular Formula | C13H16F3N3O3S |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 2-methoxy-N-[3-[2-(trifluoromethylsulfanyl)ethylcarbamoylamino]phenyl]acetamide |
| SMILES | COCC(=O)Nc1cccc(NC(=O)NCCSC(F)(F)F)c1 |
| InChI | InChI=1S/C13H16F3N3O3S/c1-22-8-11(20)18-9-3-2-4-10(7-9)19-12(21)17-5-6-23-13(14,15)16/h2-4,7H,5-6,8H2,1H3,(H,18,20)(H2,17,19,21) |
| InChIKey | IMOXFJUGULSCAI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|