C21H24ClN5O6S — CID 5111910
N-[2-[2-[4-[(3-chlorophenyl)sulfamoyl]-2-nitrophenyl]hydrazinyl]-2-oxoethyl]cyclohexanecarboxamide (PubChem CID 5111910) has the molecular formula C21H24ClN5O6S and a molecular weight of 509.97 g/mol. Its IUPAC name is N-[2-[2-[4-[(3-chlorophenyl)sulfamoyl]-2-nitrophenyl]hydrazinyl]-2-oxoethyl]cyclohexanecarboxamide.
| Compound Name | N-[2-[2-[4-[(3-chlorophenyl)sulfamoyl]-2-nitrophenyl]hydrazinyl]-2-oxoethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 5111910 |
| Molecular Formula | C21H24ClN5O6S |
| Molecular Weight | 509.97 g/mol |
| Exact Mass | 509.11 |
| IUPAC Name | N-[2-[2-[4-[(3-chlorophenyl)sulfamoyl]-2-nitrophenyl]hydrazinyl]-2-oxoethyl]cyclohexanecarboxamide |
| SMILES | O=C(CNC(=O)C1CCCCC1)NNc1ccc(S(=O)(=O)Nc2cccc(Cl)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H24ClN5O6S/c22-15-7-4-8-16(11-15)26-34(32,33)17-9-10-18(19(12-17)27(30)31)24-25-20(28)13-23-21(29)14-5-2-1-3-6-14/h4,7-12,14,24,26H,1-3,5-6,13H2,(H,23,29)(H,25,28) |
| InChIKey | IVAWDPNJEMRKJZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 159.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.97 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|