C18H17N3O5 — CID 51119555
3-[2-hydroxy-3-(3-nitrophenoxy)propyl]-6-methylquinazolin-4-one (PubChem CID 51119555) has the molecular formula C18H17N3O5 and a molecular weight of 355.35 g/mol. Its IUPAC name is 3-[2-hydroxy-3-(3-nitrophenoxy)propyl]-6-methylquinazolin-4-one.
| Compound Name | 3-[2-hydroxy-3-(3-nitrophenoxy)propyl]-6-methylquinazolin-4-one |
|---|---|
| PubChem CID | 51119555 |
| Molecular Formula | C18H17N3O5 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 3-[2-hydroxy-3-(3-nitrophenoxy)propyl]-6-methylquinazolin-4-one |
| SMILES | Cc1ccc2ncn(CC(O)COc3cccc([N+](=O)[O-])c3)c(=O)c2c1 |
| InChI | InChI=1S/C18H17N3O5/c1-12-5-6-17-16(7-12)18(23)20(11-19-17)9-14(22)10-26-15-4-2-3-13(8-15)21(24)25/h2-8,11,14,22H,9-10H2,1H3 |
| InChIKey | LPXZAQSSGSIIBQ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|