C21H16FN3O5S — CID 47021750
6-(4-fluorophenyl)-3-[2-hydroxy-3-(3-nitrophenoxy)propyl]thieno[3,2-d]pyrimidin-4-one (PubChem CID 47021750) has the molecular formula C21H16FN3O5S and a molecular weight of 441.44 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-3-[2-hydroxy-3-(3-nitrophenoxy)propyl]thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 6-(4-fluorophenyl)-3-[2-hydroxy-3-(3-nitrophenoxy)propyl]thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 47021750 |
| Molecular Formula | C21H16FN3O5S |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | 6-(4-fluorophenyl)-3-[2-hydroxy-3-(3-nitrophenoxy)propyl]thieno[3,2-d]pyrimidin-4-one |
| SMILES | O=c1c2sc(-c3ccc(F)cc3)cc2ncn1CC(O)COc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H16FN3O5S/c22-14-6-4-13(5-7-14)19-9-18-20(31-19)21(27)24(12-23-18)10-16(26)11-30-17-3-1-2-15(8-17)25(28)29/h1-9,12,16,26H,10-11H2 |
| InChIKey | STZGPYXMNJDEIG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|