C21H33N3O3 — CID 51121113
benzyl N-[4-[methyl-(1-propan-2-ylpiperidin-4-yl)amino]-4-oxobutyl]carbamate (PubChem CID 51121113) has the molecular formula C21H33N3O3 and a molecular weight of 375.51 g/mol. Its IUPAC name is benzyl N-[4-[methyl-(1-propan-2-ylpiperidin-4-yl)amino]-4-oxobutyl]carbamate.
| Compound Name | benzyl N-[4-[methyl-(1-propan-2-ylpiperidin-4-yl)amino]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 51121113 |
| Molecular Formula | C21H33N3O3 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.25 |
| IUPAC Name | benzyl N-[4-[methyl-(1-propan-2-ylpiperidin-4-yl)amino]-4-oxobutyl]carbamate |
| SMILES | CC(C)N1CCC(N(C)C(=O)CCCNC(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C21H33N3O3/c1-17(2)24-14-11-19(12-15-24)23(3)20(25)10-7-13-22-21(26)27-16-18-8-5-4-6-9-18/h4-6,8-9,17,19H,7,10-16H2,1-3H3,(H,22,26) |
| InChIKey | HNTKXHNPMRCXPG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|