C19H16Cl2N2O2S2 — CID 5112247
5-[(3,4-dichlorophenyl)methylidene]-3-[(2-ethoxyanilino)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 5112247) has the molecular formula C19H16Cl2N2O2S2 and a molecular weight of 439.39 g/mol. Its IUPAC name is 5-[(3,4-dichlorophenyl)methylidene]-3-[(2-ethoxyanilino)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[(3,4-dichlorophenyl)methylidene]-3-[(2-ethoxyanilino)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 5112247 |
| Molecular Formula | C19H16Cl2N2O2S2 |
| Molecular Weight | 439.39 g/mol |
| Exact Mass | 438.00 |
| IUPAC Name | 5-[(3,4-dichlorophenyl)methylidene]-3-[(2-ethoxyanilino)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCOc1ccccc1NCN1C(=O)C(=Cc2ccc(Cl)c(Cl)c2)SC1=S |
| InChI | InChI=1S/C19H16Cl2N2O2S2/c1-2-25-16-6-4-3-5-15(16)22-11-23-18(24)17(27-19(23)26)10-12-7-8-13(20)14(21)9-12/h3-10,22H,2,11H2,1H3 |
| InChIKey | FACUIHJOAWERAM-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.39 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|