C33H24ClF4N3O7 — CID 5112481
6a-(4-chlorophenyl)-8-(4-fluoroanilino)-2-hydroxy-6-[2-hydroxy-5-(trifluoromethoxy)phenyl]-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 5112481) has the molecular formula C33H24ClF4N3O7 and a molecular weight of 686.01 g/mol. Its IUPAC name is 6a-(4-chlorophenyl)-8-(4-fluoroanilino)-2-hydroxy-6-[2-hydroxy-5-(trifluoromethoxy)phenyl]-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6a-(4-chlorophenyl)-8-(4-fluoroanilino)-2-hydroxy-6-[2-hydroxy-5-(trifluoromethoxy)phenyl]-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 5112481 |
| Molecular Formula | C33H24ClF4N3O7 |
| Molecular Weight | 686.01 g/mol |
| Exact Mass | 685.12 |
| IUPAC Name | 6a-(4-chlorophenyl)-8-(4-fluoroanilino)-2-hydroxy-6-[2-hydroxy-5-(trifluoromethoxy)phenyl]-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | O=C1C2CC=C3C(CC4C(=O)N(Nc5ccc(F)cc5)C(=O)C4(c4ccc(Cl)cc4)C3c3cc(OC(F)(F)F)ccc3O)C2C(=O)N1O |
| InChI | InChI=1S/C33H24ClF4N3O7/c34-16-3-1-15(2-4-16)32-24(29(44)40(31(32)46)39-18-7-5-17(35)6-8-18)14-22-20(10-11-21-26(22)30(45)41(47)28(21)43)27(32)23-13-19(9-12-25(23)42)48-33(36,37)38/h1-10,12-13,21-22,24,26-27,39,42,47H,11,14H2 |
| InChIKey | QDBKMHWIGOYDSH-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 136.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.01 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|