C22H23FN2O4S — CID 51126027
1-(2,3-dihydro-1H-inden-5-yl)-2-[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]ethane-1,2-dione (PubChem CID 51126027) has the molecular formula C22H23FN2O4S and a molecular weight of 430.50 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)-2-[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]ethane-1,2-dione.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 51126027 |
| Molecular Formula | C22H23FN2O4S |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]ethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCCN(S(=O)(=O)c2ccc(F)cc2)CC1)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C22H23FN2O4S/c23-19-7-9-20(10-8-19)30(28,29)25-12-2-11-24(13-14-25)22(27)21(26)18-6-5-16-3-1-4-17(16)15-18/h5-10,15H,1-4,11-14H2 |
| InChIKey | LBEVRROOVHZGOJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|