C17H26ClN3O3 — CID 51128640
3-[[2-(3-chlorophenyl)-2-methylpropyl]carbamoylamino]-N-(2-methoxyethyl)propanamide (PubChem CID 51128640) has the molecular formula C17H26ClN3O3 and a molecular weight of 355.87 g/mol. Its IUPAC name is 3-[[2-(3-chlorophenyl)-2-methylpropyl]carbamoylamino]-N-(2-methoxyethyl)propanamide.
| Compound Name | 3-[[2-(3-chlorophenyl)-2-methylpropyl]carbamoylamino]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 51128640 |
| Molecular Formula | C17H26ClN3O3 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 3-[[2-(3-chlorophenyl)-2-methylpropyl]carbamoylamino]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)CCNC(=O)NCC(C)(C)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H26ClN3O3/c1-17(2,13-5-4-6-14(18)11-13)12-21-16(23)20-8-7-15(22)19-9-10-24-3/h4-6,11H,7-10,12H2,1-3H3,(H,19,22)(H2,20,21,23) |
| InChIKey | REMYMASZWXKMLS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|