C19H17N5O2S — CID 51129784
N-(2-imidazol-1-ylethyl)-3-(pyrimidin-2-ylsulfanylmethyl)-1-benzofuran-2-carboxamide (PubChem CID 51129784) has the molecular formula C19H17N5O2S and a molecular weight of 379.44 g/mol. Its IUPAC name is N-(2-imidazol-1-ylethyl)-3-(pyrimidin-2-ylsulfanylmethyl)-1-benzofuran-2-carboxamide.
| Compound Name | N-(2-imidazol-1-ylethyl)-3-(pyrimidin-2-ylsulfanylmethyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 51129784 |
| Molecular Formula | C19H17N5O2S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | N-(2-imidazol-1-ylethyl)-3-(pyrimidin-2-ylsulfanylmethyl)-1-benzofuran-2-carboxamide |
| SMILES | O=C(NCCn1ccnc1)c1oc2ccccc2c1CSc1ncccn1 |
| InChI | InChI=1S/C19H17N5O2S/c25-18(21-9-11-24-10-8-20-13-24)17-15(12-27-19-22-6-3-7-23-19)14-4-1-2-5-16(14)26-17/h1-8,10,13H,9,11-12H2,(H,21,25) |
| InChIKey | DKGHVGAHTWZSHJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |