C21H28N4O2 — CID 51129977
N-(3-methylbutan-2-yl)-1-(3-phenyl-1H-pyrazole-5-carbonyl)piperidine-4-carboxamide (PubChem CID 51129977) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is N-(3-methylbutan-2-yl)-1-(3-phenyl-1H-pyrazole-5-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-(3-methylbutan-2-yl)-1-(3-phenyl-1H-pyrazole-5-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 51129977 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | N-(3-methylbutan-2-yl)-1-(3-phenyl-1H-pyrazole-5-carbonyl)piperidine-4-carboxamide |
| SMILES | CC(C)C(C)NC(=O)C1CCN(C(=O)c2cc(-c3ccccc3)n[nH]2)CC1 |
| InChI | InChI=1S/C21H28N4O2/c1-14(2)15(3)22-20(26)17-9-11-25(12-10-17)21(27)19-13-18(23-24-19)16-7-5-4-6-8-16/h4-8,13-15,17H,9-12H2,1-3H3,(H,22,26)(H,23,24) |
| InChIKey | WSKNAFDMIIZBCO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |