C22H24ClN3O3 — CID 51133132
2-(5-chloroquinolin-8-yl)oxy-N-[2-(5-methylfuran-2-yl)-2-pyrrolidin-1-ylethyl]acetamide (PubChem CID 51133132) has the molecular formula C22H24ClN3O3 and a molecular weight of 413.91 g/mol. Its IUPAC name is 2-(5-chloroquinolin-8-yl)oxy-N-[2-(5-methylfuran-2-yl)-2-pyrrolidin-1-ylethyl]acetamide.
| Compound Name | 2-(5-chloroquinolin-8-yl)oxy-N-[2-(5-methylfuran-2-yl)-2-pyrrolidin-1-ylethyl]acetamide |
|---|---|
| PubChem CID | 51133132 |
| Molecular Formula | C22H24ClN3O3 |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 2-(5-chloroquinolin-8-yl)oxy-N-[2-(5-methylfuran-2-yl)-2-pyrrolidin-1-ylethyl]acetamide |
| SMILES | Cc1ccc(C(CNC(=O)COc2ccc(Cl)c3cccnc23)N2CCCC2)o1 |
| InChI | InChI=1S/C22H24ClN3O3/c1-15-6-8-19(29-15)18(26-11-2-3-12-26)13-25-21(27)14-28-20-9-7-17(23)16-5-4-10-24-22(16)20/h4-10,18H,2-3,11-14H2,1H3,(H,25,27) |
| InChIKey | WVCDKZWXJVMYRN-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |