C22H28FN3O4 — CID 51133219
2-[[2-(3-fluoro-4-methoxy-N-propan-2-ylanilino)acetyl]amino]-N-(2-methoxy-5-methylphenyl)acetamide (PubChem CID 51133219) has the molecular formula C22H28FN3O4 and a molecular weight of 417.48 g/mol. Its IUPAC name is 2-[[2-(3-fluoro-4-methoxy-N-propan-2-ylanilino)acetyl]amino]-N-(2-methoxy-5-methylphenyl)acetamide.
| Compound Name | 2-[[2-(3-fluoro-4-methoxy-N-propan-2-ylanilino)acetyl]amino]-N-(2-methoxy-5-methylphenyl)acetamide |
|---|---|
| PubChem CID | 51133219 |
| Molecular Formula | C22H28FN3O4 |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 2-[[2-(3-fluoro-4-methoxy-N-propan-2-ylanilino)acetyl]amino]-N-(2-methoxy-5-methylphenyl)acetamide |
| SMILES | COc1ccc(N(CC(=O)NCC(=O)Nc2cc(C)ccc2OC)C(C)C)cc1F |
| InChI | InChI=1S/C22H28FN3O4/c1-14(2)26(16-7-9-19(29-4)17(23)11-16)13-22(28)24-12-21(27)25-18-10-15(3)6-8-20(18)30-5/h6-11,14H,12-13H2,1-5H3,(H,24,28)(H,25,27) |
| InChIKey | SMODEYIEGSLGJE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|