C19H14IN3O2S — CID 51133637
N-(4-cyanophenyl)-2-(4-iodophenoxy)-N-(4-methyl-1,3-thiazol-2-yl)acetamide (PubChem CID 51133637) has the molecular formula C19H14IN3O2S and a molecular weight of 475.31 g/mol. Its IUPAC name is N-(4-cyanophenyl)-2-(4-iodophenoxy)-N-(4-methyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | N-(4-cyanophenyl)-2-(4-iodophenoxy)-N-(4-methyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 51133637 |
| Molecular Formula | C19H14IN3O2S |
| Molecular Weight | 475.31 g/mol |
| Exact Mass | 474.99 |
| IUPAC Name | N-(4-cyanophenyl)-2-(4-iodophenoxy)-N-(4-methyl-1,3-thiazol-2-yl)acetamide |
| SMILES | Cc1csc(N(C(=O)COc2ccc(I)cc2)c2ccc(C#N)cc2)n1 |
| InChI | InChI=1S/C19H14IN3O2S/c1-13-12-26-19(22-13)23(16-6-2-14(10-21)3-7-16)18(24)11-25-17-8-4-15(20)5-9-17/h2-9,12H,11H2,1H3 |
| InChIKey | XAUXYEVGHVWYRY-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 66.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.31 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|