C22H22N2O3S — CID 16549645
2-(2-methoxy-4-prop-2-enylphenoxy)-N-(4-methyl-1,3-thiazol-2-yl)-N-phenylacetamide (PubChem CID 16549645) has the molecular formula C22H22N2O3S and a molecular weight of 394.50 g/mol. Its IUPAC name is 2-(2-methoxy-4-prop-2-enylphenoxy)-N-(4-methyl-1,3-thiazol-2-yl)-N-phenylacetamide.
| Compound Name | 2-(2-methoxy-4-prop-2-enylphenoxy)-N-(4-methyl-1,3-thiazol-2-yl)-N-phenylacetamide |
|---|---|
| PubChem CID | 16549645 |
| Molecular Formula | C22H22N2O3S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 2-(2-methoxy-4-prop-2-enylphenoxy)-N-(4-methyl-1,3-thiazol-2-yl)-N-phenylacetamide |
| SMILES | C=CCc1ccc(OCC(=O)N(c2ccccc2)c2nc(C)cs2)c(OC)c1 |
| InChI | InChI=1S/C22H22N2O3S/c1-4-8-17-11-12-19(20(13-17)26-3)27-14-21(25)24(18-9-6-5-7-10-18)22-23-16(2)15-28-22/h4-7,9-13,15H,1,8,14H2,2-3H3 |
| InChIKey | FXKNCVUXZOTCLI-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|