C15H16ClF2N3OS — CID 51134602
3-(4-chlorophenyl)sulfanyl-N-[2-[1-(difluoromethyl)imidazol-2-yl]ethyl]propanamide (PubChem CID 51134602) has the molecular formula C15H16ClF2N3OS and a molecular weight of 359.83 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfanyl-N-[2-[1-(difluoromethyl)imidazol-2-yl]ethyl]propanamide.
| Compound Name | 3-(4-chlorophenyl)sulfanyl-N-[2-[1-(difluoromethyl)imidazol-2-yl]ethyl]propanamide |
|---|---|
| PubChem CID | 51134602 |
| Molecular Formula | C15H16ClF2N3OS |
| Molecular Weight | 359.83 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 3-(4-chlorophenyl)sulfanyl-N-[2-[1-(difluoromethyl)imidazol-2-yl]ethyl]propanamide |
| SMILES | O=C(CCSc1ccc(Cl)cc1)NCCc1nccn1C(F)F |
| InChI | InChI=1S/C15H16ClF2N3OS/c16-11-1-3-12(4-2-11)23-10-6-14(22)20-7-5-13-19-8-9-21(13)15(17)18/h1-4,8-9,15H,5-7,10H2,(H,20,22) |
| InChIKey | MTYLGVKCBUZCBT-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.83 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |