C25H33N3O3 — CID 51134750
1-[[1-[3-(2-ethoxyphenyl)propanoyl]piperidin-3-yl]methyl]-3-(4-methylphenyl)urea (PubChem CID 51134750) has the molecular formula C25H33N3O3 and a molecular weight of 423.56 g/mol. Its IUPAC name is 1-[[1-[3-(2-ethoxyphenyl)propanoyl]piperidin-3-yl]methyl]-3-(4-methylphenyl)urea.
| Compound Name | 1-[[1-[3-(2-ethoxyphenyl)propanoyl]piperidin-3-yl]methyl]-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 51134750 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | 1-[[1-[3-(2-ethoxyphenyl)propanoyl]piperidin-3-yl]methyl]-3-(4-methylphenyl)urea |
| SMILES | CCOc1ccccc1CCC(=O)N1CCCC(CNC(=O)Nc2ccc(C)cc2)C1 |
| InChI | InChI=1S/C25H33N3O3/c1-3-31-23-9-5-4-8-21(23)12-15-24(29)28-16-6-7-20(18-28)17-26-25(30)27-22-13-10-19(2)11-14-22/h4-5,8-11,13-14,20H,3,6-7,12,15-18H2,1-2H3,(H2,26,27,30) |
| InChIKey | VDZWGXYKTFULFS-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |