C28H26FN5O3 — CID 51134759
1-(3-fluorophenyl)-3-[[1-(4-oxo-3-phenylphthalazine-1-carbonyl)piperidin-3-yl]methyl]urea (PubChem CID 51134759) has the molecular formula C28H26FN5O3 and a molecular weight of 499.55 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3-[[1-(4-oxo-3-phenylphthalazine-1-carbonyl)piperidin-3-yl]methyl]urea.
| Compound Name | 1-(3-fluorophenyl)-3-[[1-(4-oxo-3-phenylphthalazine-1-carbonyl)piperidin-3-yl]methyl]urea |
|---|---|
| PubChem CID | 51134759 |
| Molecular Formula | C28H26FN5O3 |
| Molecular Weight | 499.55 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | 1-(3-fluorophenyl)-3-[[1-(4-oxo-3-phenylphthalazine-1-carbonyl)piperidin-3-yl]methyl]urea |
| SMILES | O=C(NCC1CCCN(C(=O)c2nn(-c3ccccc3)c(=O)c3ccccc23)C1)Nc1cccc(F)c1 |
| InChI | InChI=1S/C28H26FN5O3/c29-20-9-6-10-21(16-20)31-28(37)30-17-19-8-7-15-33(18-19)27(36)25-23-13-4-5-14-24(23)26(35)34(32-25)22-11-2-1-3-12-22/h1-6,9-14,16,19H,7-8,15,17-18H2,(H2,30,31,37) |
| InChIKey | XWWIYAASABPAAJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |