C22H35N3O2 — CID 51135124
2-[cyclohexyl(2-hydroxypropyl)amino]-N-(2-methyl-4-pyrrolidin-1-ylphenyl)acetamide (PubChem CID 51135124) has the molecular formula C22H35N3O2 and a molecular weight of 373.54 g/mol. Its IUPAC name is 2-[cyclohexyl(2-hydroxypropyl)amino]-N-(2-methyl-4-pyrrolidin-1-ylphenyl)acetamide.
| Compound Name | 2-[cyclohexyl(2-hydroxypropyl)amino]-N-(2-methyl-4-pyrrolidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 51135124 |
| Molecular Formula | C22H35N3O2 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.27 |
| IUPAC Name | 2-[cyclohexyl(2-hydroxypropyl)amino]-N-(2-methyl-4-pyrrolidin-1-ylphenyl)acetamide |
| SMILES | Cc1cc(N2CCCC2)ccc1NC(=O)CN(CC(C)O)C1CCCCC1 |
| InChI | InChI=1S/C22H35N3O2/c1-17-14-20(24-12-6-7-13-24)10-11-21(17)23-22(27)16-25(15-18(2)26)19-8-4-3-5-9-19/h10-11,14,18-19,26H,3-9,12-13,15-16H2,1-2H3,(H,23,27) |
| InChIKey | MYQIFHUZNZRRRE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|