C23H29N3O — CID 51138072
(9S,11S)-3-but-2-ynyl-N-cyclopropyl-9-(2-methylpropyl)-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene-11-carboxamide (PubChem CID 51138072) has the molecular formula C23H29N3O and a molecular weight of 363.51 g/mol. Its IUPAC name is (9S,11S)-3-but-2-ynyl-N-cyclopropyl-9-(2-methylpropyl)-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene-11-carboxamide.
| Compound Name | (9S,11S)-3-but-2-ynyl-N-cyclopropyl-9-(2-methylpropyl)-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene-11-carboxamide |
|---|---|
| PubChem CID | 51138072 |
| Molecular Formula | C23H29N3O |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | (9S,11S)-3-but-2-ynyl-N-cyclopropyl-9-(2-methylpropyl)-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene-11-carboxamide |
| SMILES | CC#CCn1cc2c3c(cccc31)[C@H](CC(C)C)N[C@H](C(=O)NC1CC1)C2 |
| InChI | InChI=1S/C23H29N3O/c1-4-5-11-26-14-16-13-20(23(27)24-17-9-10-17)25-19(12-15(2)3)18-7-6-8-21(26)22(16)18/h6-8,14-15,17,19-20,25H,9-13H2,1-3H3,(H,24,27)/t19-,20-/m0/s1 |
| InChIKey | URTYUMNYELKECL-PMACEKPBSA-N |
| XLogP | 3.54 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|