C16H18N4O3S — CID 5114070
3-[4-[[2-oxo-2-[(5-propyl-1,3,4-thiadiazol-2-yl)amino]ethyl]amino]phenyl]prop-2-enoic acid (PubChem CID 5114070) has the molecular formula C16H18N4O3S and a molecular weight of 346.41 g/mol. Its IUPAC name is 3-[4-[[2-oxo-2-[(5-propyl-1,3,4-thiadiazol-2-yl)amino]ethyl]amino]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[[2-oxo-2-[(5-propyl-1,3,4-thiadiazol-2-yl)amino]ethyl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 5114070 |
| Molecular Formula | C16H18N4O3S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 3-[4-[[2-oxo-2-[(5-propyl-1,3,4-thiadiazol-2-yl)amino]ethyl]amino]phenyl]prop-2-enoic acid |
| SMILES | CCCc1nnc(NC(=O)CNc2ccc(C=CC(=O)O)cc2)s1 |
| InChI | InChI=1S/C16H18N4O3S/c1-2-3-14-19-20-16(24-14)18-13(21)10-17-12-7-4-11(5-8-12)6-9-15(22)23/h4-9,17H,2-3,10H2,1H3,(H,22,23)(H,18,20,21) |
| InChIKey | GDXSKBOXGKCOQM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|