C18H18F2N4O3 — CID 51142198
N-[4-(difluoromethoxy)phenyl]-2-[2-(2-hydroxyethylamino)benzimidazol-1-yl]acetamide (PubChem CID 51142198) has the molecular formula C18H18F2N4O3 and a molecular weight of 376.36 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)phenyl]-2-[2-(2-hydroxyethylamino)benzimidazol-1-yl]acetamide.
| Compound Name | N-[4-(difluoromethoxy)phenyl]-2-[2-(2-hydroxyethylamino)benzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 51142198 |
| Molecular Formula | C18H18F2N4O3 |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | N-[4-(difluoromethoxy)phenyl]-2-[2-(2-hydroxyethylamino)benzimidazol-1-yl]acetamide |
| SMILES | O=C(Cn1c(NCCO)nc2ccccc21)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C18H18F2N4O3/c19-17(20)27-13-7-5-12(6-8-13)22-16(26)11-24-15-4-2-1-3-14(15)23-18(24)21-9-10-25/h1-8,17,25H,9-11H2,(H,21,23)(H,22,26) |
| InChIKey | YYORXBSILLZDFS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |