C18H18N2O3S2 — CID 51142904
3-(2-methylphenyl)-2-(2-methylsulfonylethylsulfanyl)quinazolin-4-one (PubChem CID 51142904) has the molecular formula C18H18N2O3S2 and a molecular weight of 374.49 g/mol. Its IUPAC name is 3-(2-methylphenyl)-2-(2-methylsulfonylethylsulfanyl)quinazolin-4-one.
| Compound Name | 3-(2-methylphenyl)-2-(2-methylsulfonylethylsulfanyl)quinazolin-4-one |
|---|---|
| PubChem CID | 51142904 |
| Molecular Formula | C18H18N2O3S2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 3-(2-methylphenyl)-2-(2-methylsulfonylethylsulfanyl)quinazolin-4-one |
| SMILES | Cc1ccccc1-n1c(SCCS(C)(=O)=O)nc2ccccc2c1=O |
| InChI | InChI=1S/C18H18N2O3S2/c1-13-7-3-6-10-16(13)20-17(21)14-8-4-5-9-15(14)19-18(20)24-11-12-25(2,22)23/h3-10H,11-12H2,1-2H3 |
| InChIKey | HWPNHRBARKHJHE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 69.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |