C21H26ClN3OS — CID 44656000
diethyl-[2-[3-(2-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylethyl]azanium chloride (PubChem CID 44656000) has the molecular formula C21H26ClN3OS and a molecular weight of 403.98 g/mol. Its IUPAC name is diethyl-[2-[3-(2-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylethyl]azanium chloride.
| Compound Name | diethyl-[2-[3-(2-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylethyl]azanium chloride |
|---|---|
| PubChem CID | 44656000 |
| Molecular Formula | C21H26ClN3OS |
| Molecular Weight | 403.98 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | diethyl-[2-[3-(2-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylethyl]azanium chloride |
| SMILES | CC[NH+](CC)CCSc1nc2ccccc2c(=O)n1-c1ccccc1C.[Cl-] |
| InChI | InChI=1S/C21H25N3OS.ClH/c1-4-23(5-2)14-15-26-21-22-18-12-8-7-11-17(18)20(25)24(21)19-13-9-6-10-16(19)3;/h6-13H,4-5,14-15H2,1-3H3;1H |
| InChIKey | ZMCZFPBYGAYJDI-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.98 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |