C19H24ClN3O3 — CID 51145123
4-chloro-N-[4-[[2-(dimethylamino)-2-(furan-2-yl)ethyl]amino]-4-oxobutyl]benzamide (PubChem CID 51145123) has the molecular formula C19H24ClN3O3 and a molecular weight of 377.87 g/mol. Its IUPAC name is 4-chloro-N-[4-[[2-(dimethylamino)-2-(furan-2-yl)ethyl]amino]-4-oxobutyl]benzamide.
| Compound Name | 4-chloro-N-[4-[[2-(dimethylamino)-2-(furan-2-yl)ethyl]amino]-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 51145123 |
| Molecular Formula | C19H24ClN3O3 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 4-chloro-N-[4-[[2-(dimethylamino)-2-(furan-2-yl)ethyl]amino]-4-oxobutyl]benzamide |
| SMILES | CN(C)C(CNC(=O)CCCNC(=O)c1ccc(Cl)cc1)c1ccco1 |
| InChI | InChI=1S/C19H24ClN3O3/c1-23(2)16(17-5-4-12-26-17)13-22-18(24)6-3-11-21-19(25)14-7-9-15(20)10-8-14/h4-5,7-10,12,16H,3,6,11,13H2,1-2H3,(H,21,25)(H,22,24) |
| InChIKey | BCDMFUVDUQNSEP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|