C19H26N6O3 — CID 51148609
2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]acetamide (PubChem CID 51148609) has the molecular formula C19H26N6O3 and a molecular weight of 386.46 g/mol. Its IUPAC name is 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]acetamide.
| Compound Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 51148609 |
| Molecular Formula | C19H26N6O3 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]acetamide |
| SMILES | Cc1cc(N2CCN(C)CC2)ccc1NC(=O)Cn1nc(C)c([N+](=O)[O-])c1C |
| InChI | InChI=1S/C19H26N6O3/c1-13-11-16(23-9-7-22(4)8-10-23)5-6-17(13)20-18(26)12-24-15(3)19(25(27)28)14(2)21-24/h5-6,11H,7-10,12H2,1-4H3,(H,20,26) |
| InChIKey | NTKGFSWJHTURSZ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 96.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|