C18H21ClN2O2S — CID 51151878
4-chloro-N-[3-methyl-1-oxo-1-(1-thiophen-2-ylethylamino)butan-2-yl]benzamide (PubChem CID 51151878) has the molecular formula C18H21ClN2O2S and a molecular weight of 364.90 g/mol. Its IUPAC name is 4-chloro-N-[3-methyl-1-oxo-1-(1-thiophen-2-ylethylamino)butan-2-yl]benzamide.
| Compound Name | 4-chloro-N-[3-methyl-1-oxo-1-(1-thiophen-2-ylethylamino)butan-2-yl]benzamide |
|---|---|
| PubChem CID | 51151878 |
| Molecular Formula | C18H21ClN2O2S |
| Molecular Weight | 364.90 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 4-chloro-N-[3-methyl-1-oxo-1-(1-thiophen-2-ylethylamino)butan-2-yl]benzamide |
| SMILES | CC(NC(=O)C(NC(=O)c1ccc(Cl)cc1)C(C)C)c1cccs1 |
| InChI | InChI=1S/C18H21ClN2O2S/c1-11(2)16(18(23)20-12(3)15-5-4-10-24-15)21-17(22)13-6-8-14(19)9-7-13/h4-12,16H,1-3H3,(H,20,23)(H,21,22) |
| InChIKey | LVRJGAFGHADCAZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.90 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |