C22H18N2O4 — CID 51153526
N-(3-oxo-4H-1,4-benzoxazin-6-yl)-2-(2-phenylphenoxy)acetamide (PubChem CID 51153526) has the molecular formula C22H18N2O4 and a molecular weight of 374.40 g/mol. Its IUPAC name is N-(3-oxo-4H-1,4-benzoxazin-6-yl)-2-(2-phenylphenoxy)acetamide.
| Compound Name | N-(3-oxo-4H-1,4-benzoxazin-6-yl)-2-(2-phenylphenoxy)acetamide |
|---|---|
| PubChem CID | 51153526 |
| Molecular Formula | C22H18N2O4 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | N-(3-oxo-4H-1,4-benzoxazin-6-yl)-2-(2-phenylphenoxy)acetamide |
| SMILES | O=C(COc1ccccc1-c1ccccc1)Nc1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C22H18N2O4/c25-21(23-16-10-11-20-18(12-16)24-22(26)14-28-20)13-27-19-9-5-4-8-17(19)15-6-2-1-3-7-15/h1-12H,13-14H2,(H,23,25)(H,24,26) |
| InChIKey | GOLKITPTCNCNHG-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |