C15H13N3O4 — CID 51175989
N-(3-oxo-4H-1,4-benzoxazin-6-yl)-2-(2-oxo-1-pyridinyl)acetamide (PubChem CID 51175989) has the molecular formula C15H13N3O4 and a molecular weight of 299.29 g/mol. Its IUPAC name is N-(3-oxo-4H-1,4-benzoxazin-6-yl)-2-(2-oxo-1-pyridinyl)acetamide.
| Compound Name | N-(3-oxo-4H-1,4-benzoxazin-6-yl)-2-(2-oxo-1-pyridinyl)acetamide |
|---|---|
| PubChem CID | 51175989 |
| Molecular Formula | C15H13N3O4 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | N-(3-oxo-4H-1,4-benzoxazin-6-yl)-2-(2-oxo-1-pyridinyl)acetamide |
| SMILES | O=C(Cn1ccccc1=O)Nc1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C15H13N3O4/c19-13(8-18-6-2-1-3-15(18)21)16-10-4-5-12-11(7-10)17-14(20)9-22-12/h1-7H,8-9H2,(H,16,19)(H,17,20) |
| InChIKey | BAZQNZAVWJPRDU-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |