C18H26N2O4 — CID 51161913
N-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-3,4-dimethoxybenzamide (PubChem CID 51161913) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is N-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 51161913 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | N-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCC(=O)N2CC(C)CC(C)C2)cc1OC |
| InChI | InChI=1S/C18H26N2O4/c1-12-7-13(2)11-20(10-12)17(21)9-19-18(22)14-5-6-15(23-3)16(8-14)24-4/h5-6,8,12-13H,7,9-11H2,1-4H3,(H,19,22) |
| InChIKey | PGLRKRRHCMULPF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |