C18H26N2O2 — CID 43002406
N-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-3,5-dimethylbenzamide (PubChem CID 43002406) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is N-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-3,5-dimethylbenzamide.
| Compound Name | N-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-3,5-dimethylbenzamide |
|---|---|
| PubChem CID | 43002406 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | N-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-3,5-dimethylbenzamide |
| SMILES | Cc1cc(C)cc(C(=O)NCC(=O)N2CC(C)CC(C)C2)c1 |
| InChI | InChI=1S/C18H26N2O2/c1-12-5-13(2)8-16(7-12)18(22)19-9-17(21)20-10-14(3)6-15(4)11-20/h5,7-8,14-15H,6,9-11H2,1-4H3,(H,19,22) |
| InChIKey | MNGHWBNKNYKMQU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |