C17H21N3O6 — CID 122117427
5-methyl-1-[2-[(3-methyl-4-nitrobenzoyl)amino]acetyl]piperidine-3-carboxylic acid (PubChem CID 122117427) has the molecular formula C17H21N3O6 and a molecular weight of 363.37 g/mol. Its IUPAC name is 5-methyl-1-[2-[(3-methyl-4-nitrobenzoyl)amino]acetyl]piperidine-3-carboxylic acid.
| Compound Name | 5-methyl-1-[2-[(3-methyl-4-nitrobenzoyl)amino]acetyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122117427 |
| Molecular Formula | C17H21N3O6 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 5-methyl-1-[2-[(3-methyl-4-nitrobenzoyl)amino]acetyl]piperidine-3-carboxylic acid |
| SMILES | Cc1cc(C(=O)NCC(=O)N2CC(C)CC(C(=O)O)C2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H21N3O6/c1-10-5-13(17(23)24)9-19(8-10)15(21)7-18-16(22)12-3-4-14(20(25)26)11(2)6-12/h3-4,6,10,13H,5,7-9H2,1-2H3,(H,18,22)(H,23,24) |
| InChIKey | KPLBEAVBJYXVLG-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|