C16H22Cl2N2O2 — CID 51162655
2,2-dichloro-N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-1-methylcyclopropane-1-carboxamide (PubChem CID 51162655) has the molecular formula C16H22Cl2N2O2 and a molecular weight of 345.27 g/mol. Its IUPAC name is 2,2-dichloro-N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-1-methylcyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 51162655 |
| Molecular Formula | C16H22Cl2N2O2 |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 2,2-dichloro-N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-1-methylcyclopropane-1-carboxamide |
| SMILES | CC1(C(=O)NCC(c2ccco2)N2CCCCC2)CC1(Cl)Cl |
| InChI | InChI=1S/C16H22Cl2N2O2/c1-15(11-16(15,17)18)14(21)19-10-12(13-6-5-9-22-13)20-7-3-2-4-8-20/h5-6,9,12H,2-4,7-8,10-11H2,1H3,(H,19,21) |
| InChIKey | OLTQJBHYDBSNRG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|