C19H26N2O2 — CID 51163154
N-[2-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-2-oxoethyl]-3-methylbenzamide (PubChem CID 51163154) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is N-[2-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-2-oxoethyl]-3-methylbenzamide.
| Compound Name | N-[2-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-2-oxoethyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 51163154 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | N-[2-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-2-oxoethyl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)NCC(=O)NC(C)C2CC3CCC2C3)c1 |
| InChI | InChI=1S/C19H26N2O2/c1-12-4-3-5-16(8-12)19(23)20-11-18(22)21-13(2)17-10-14-6-7-15(17)9-14/h3-5,8,13-15,17H,6-7,9-11H2,1-2H3,(H,20,23)(H,21,22) |
| InChIKey | JWNOEHCBJCABOH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |