C14H13ClN4O3 — CID 51163217
N'-[2-(4-chlorophenyl)acetyl]-1-methyl-6-oxopyridazine-3-carbohydrazide (PubChem CID 51163217) has the molecular formula C14H13ClN4O3 and a molecular weight of 320.74 g/mol. Its IUPAC name is N'-[2-(4-chlorophenyl)acetyl]-1-methyl-6-oxopyridazine-3-carbohydrazide.
| Compound Name | N'-[2-(4-chlorophenyl)acetyl]-1-methyl-6-oxopyridazine-3-carbohydrazide |
|---|---|
| PubChem CID | 51163217 |
| Molecular Formula | C14H13ClN4O3 |
| Molecular Weight | 320.74 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | N'-[2-(4-chlorophenyl)acetyl]-1-methyl-6-oxopyridazine-3-carbohydrazide |
| SMILES | Cn1nc(C(=O)NNC(=O)Cc2ccc(Cl)cc2)ccc1=O |
| InChI | InChI=1S/C14H13ClN4O3/c1-19-13(21)7-6-11(18-19)14(22)17-16-12(20)8-9-2-4-10(15)5-3-9/h2-7H,8H2,1H3,(H,16,20)(H,17,22) |
| InChIKey | LHJXEDANZUQNIE-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.74 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|