C17H20N4O5 — CID 24553901
1-(2-methoxyethyl)-N'-[2-(4-methoxyphenyl)acetyl]-6-oxopyridazine-3-carbohydrazide (PubChem CID 24553901) has the molecular formula C17H20N4O5 and a molecular weight of 360.37 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-N'-[2-(4-methoxyphenyl)acetyl]-6-oxopyridazine-3-carbohydrazide.
| Compound Name | 1-(2-methoxyethyl)-N'-[2-(4-methoxyphenyl)acetyl]-6-oxopyridazine-3-carbohydrazide |
|---|---|
| PubChem CID | 24553901 |
| Molecular Formula | C17H20N4O5 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 1-(2-methoxyethyl)-N'-[2-(4-methoxyphenyl)acetyl]-6-oxopyridazine-3-carbohydrazide |
| SMILES | COCCn1nc(C(=O)NNC(=O)Cc2ccc(OC)cc2)ccc1=O |
| InChI | InChI=1S/C17H20N4O5/c1-25-10-9-21-16(23)8-7-14(20-21)17(24)19-18-15(22)11-12-3-5-13(26-2)6-4-12/h3-8H,9-11H2,1-2H3,(H,18,22)(H,19,24) |
| InChIKey | SEXUOVZNQKOJQH-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|