C15H15ClN4O4 — CID 37349424
N'-(3-chlorobenzoyl)-1-(2-methoxyethyl)-6-oxopyridazine-3-carbohydrazide (PubChem CID 37349424) has the molecular formula C15H15ClN4O4 and a molecular weight of 350.76 g/mol. Its IUPAC name is N'-(3-chlorobenzoyl)-1-(2-methoxyethyl)-6-oxopyridazine-3-carbohydrazide.
| Compound Name | N'-(3-chlorobenzoyl)-1-(2-methoxyethyl)-6-oxopyridazine-3-carbohydrazide |
|---|---|
| PubChem CID | 37349424 |
| Molecular Formula | C15H15ClN4O4 |
| Molecular Weight | 350.76 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | N'-(3-chlorobenzoyl)-1-(2-methoxyethyl)-6-oxopyridazine-3-carbohydrazide |
| SMILES | COCCn1nc(C(=O)NNC(=O)c2cccc(Cl)c2)ccc1=O |
| InChI | InChI=1S/C15H15ClN4O4/c1-24-8-7-20-13(21)6-5-12(19-20)15(23)18-17-14(22)10-3-2-4-11(16)9-10/h2-6,9H,7-8H2,1H3,(H,17,22)(H,18,23) |
| InChIKey | MMOBASXDKZZXMI-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.76 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|