C22H22N4O5 — CID 55429869
1-(2-methoxyethyl)-N-[2-[(3-methoxyphenyl)carbamoyl]phenyl]-6-oxopyridazine-3-carboxamide (PubChem CID 55429869) has the molecular formula C22H22N4O5 and a molecular weight of 422.44 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-N-[2-[(3-methoxyphenyl)carbamoyl]phenyl]-6-oxopyridazine-3-carboxamide.
| Compound Name | 1-(2-methoxyethyl)-N-[2-[(3-methoxyphenyl)carbamoyl]phenyl]-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 55429869 |
| Molecular Formula | C22H22N4O5 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 1-(2-methoxyethyl)-N-[2-[(3-methoxyphenyl)carbamoyl]phenyl]-6-oxopyridazine-3-carboxamide |
| SMILES | COCCn1nc(C(=O)Nc2ccccc2C(=O)Nc2cccc(OC)c2)ccc1=O |
| InChI | InChI=1S/C22H22N4O5/c1-30-13-12-26-20(27)11-10-19(25-26)22(29)24-18-9-4-3-8-17(18)21(28)23-15-6-5-7-16(14-15)31-2/h3-11,14H,12-13H2,1-2H3,(H,23,28)(H,24,29) |
| InChIKey | YXIJKAIKUSDIKZ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |