C20H21N3O4 — CID 46691833
1-(2-methoxyethyl)-N-[(6-methoxynaphthalen-2-yl)methyl]-6-oxopyridazine-3-carboxamide (PubChem CID 46691833) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-N-[(6-methoxynaphthalen-2-yl)methyl]-6-oxopyridazine-3-carboxamide.
| Compound Name | 1-(2-methoxyethyl)-N-[(6-methoxynaphthalen-2-yl)methyl]-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 46691833 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 1-(2-methoxyethyl)-N-[(6-methoxynaphthalen-2-yl)methyl]-6-oxopyridazine-3-carboxamide |
| SMILES | COCCn1nc(C(=O)NCc2ccc3cc(OC)ccc3c2)ccc1=O |
| InChI | InChI=1S/C20H21N3O4/c1-26-10-9-23-19(24)8-7-18(22-23)20(25)21-13-14-3-4-16-12-17(27-2)6-5-15(16)11-14/h3-8,11-12H,9-10,13H2,1-2H3,(H,21,25) |
| InChIKey | ISJBEYWPVBFGDP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |