C19H21F2N3O3 — CID 51168376
2-[[4-(difluoromethoxy)phenyl]methyl-methylamino]-N-(methylcarbamoyl)-2-phenylacetamide (PubChem CID 51168376) has the molecular formula C19H21F2N3O3 and a molecular weight of 377.39 g/mol. Its IUPAC name is 2-[[4-(difluoromethoxy)phenyl]methyl-methylamino]-N-(methylcarbamoyl)-2-phenylacetamide.
| Compound Name | 2-[[4-(difluoromethoxy)phenyl]methyl-methylamino]-N-(methylcarbamoyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 51168376 |
| Molecular Formula | C19H21F2N3O3 |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 2-[[4-(difluoromethoxy)phenyl]methyl-methylamino]-N-(methylcarbamoyl)-2-phenylacetamide |
| SMILES | CNC(=O)NC(=O)C(c1ccccc1)N(C)Cc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C19H21F2N3O3/c1-22-19(26)23-17(25)16(14-6-4-3-5-7-14)24(2)12-13-8-10-15(11-9-13)27-18(20)21/h3-11,16,18H,12H2,1-2H3,(H2,22,23,25,26) |
| InChIKey | WVMGJEWPOVRGDM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |