C19H23N3O2 — CID 8517511
(2R)-N-(methylcarbamoyl)-2-[methyl-[(4-methylphenyl)methyl]amino]-2-phenylacetamide (PubChem CID 8517511) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is (2R)-N-(methylcarbamoyl)-2-[methyl-[(4-methylphenyl)methyl]amino]-2-phenylacetamide.
| Compound Name | (2R)-N-(methylcarbamoyl)-2-[methyl-[(4-methylphenyl)methyl]amino]-2-phenylacetamide |
|---|---|
| PubChem CID | 8517511 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | (2R)-N-(methylcarbamoyl)-2-[methyl-[(4-methylphenyl)methyl]amino]-2-phenylacetamide |
| SMILES | CNC(=O)NC(=O)[C@@H](c1ccccc1)N(C)Cc1ccc(C)cc1 |
| InChI | InChI=1S/C19H23N3O2/c1-14-9-11-15(12-10-14)13-22(3)17(16-7-5-4-6-8-16)18(23)21-19(24)20-2/h4-12,17H,13H2,1-3H3,(H2,20,21,23,24)/t17-/m1/s1 |
| InChIKey | FQTWXXSSRMTBOR-QGZVFWFLSA-N |
| XLogP | 2.62 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |